C34H28N4O2 — CID 11114077
benzotriazol-1-yl (2S)-3-phenyl-2-(tritylamino)propanoate (PubChem CID 11114077) has the molecular formula C34H28N4O2 and a molecular weight of 524.62 g/mol. Its IUPAC name is benzotriazol-1-yl (2S)-3-phenyl-2-(tritylamino)propanoate.
| Compound Name | benzotriazol-1-yl (2S)-3-phenyl-2-(tritylamino)propanoate |
|---|---|
| PubChem CID | 11114077 |
| Molecular Formula | C34H28N4O2 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | benzotriazol-1-yl (2S)-3-phenyl-2-(tritylamino)propanoate |
| SMILES | O=C(On1nnc2ccccc21)[C@H](Cc1ccccc1)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H28N4O2/c39-33(40-38-32-24-14-13-23-30(32)36-37-38)31(25-26-15-5-1-6-16-26)35-34(27-17-7-2-8-18-27,28-19-9-3-10-20-28)29-21-11-4-12-22-29/h1-24,31,35H,25H2/t31-/m0/s1 |
| InChIKey | HCBAXYBKQLIACX-HKBQPEDESA-N |
| XLogP | 5.58 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ester_of_HOBT', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|