C44H40N4O6 — CID 71146927
(2,4-dimethoxyphenyl)methyl (2R)-3-[4-(benzotriazol-1-yloxymethoxy)phenyl]-2-(tritylamino)propanoate (PubChem CID 71146927) has the molecular formula C44H40N4O6 and a molecular weight of 720.83 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)methyl (2R)-3-[4-(benzotriazol-1-yloxymethoxy)phenyl]-2-(tritylamino)propanoate.
| Compound Name | (2,4-dimethoxyphenyl)methyl (2R)-3-[4-(benzotriazol-1-yloxymethoxy)phenyl]-2-(tritylamino)propanoate |
|---|---|
| PubChem CID | 71146927 |
| Molecular Formula | C44H40N4O6 |
| Molecular Weight | 720.83 g/mol |
| Exact Mass | 720.29 |
| IUPAC Name | (2,4-dimethoxyphenyl)methyl (2R)-3-[4-(benzotriazol-1-yloxymethoxy)phenyl]-2-(tritylamino)propanoate |
| SMILES | COc1ccc(COC(=O)[C@@H](Cc2ccc(OCOn3nnc4ccccc43)cc2)NC(c2ccccc2)(c2ccccc2)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C44H40N4O6/c1-50-38-27-24-33(42(29-38)51-2)30-52-43(49)40(28-32-22-25-37(26-23-32)53-31-54-48-41-21-13-12-20-39(41)46-47-48)45-44(34-14-6-3-7-15-34,35-16-8-4-9-17-35)36-18-10-5-11-19-36/h3-27,29,40,45H,28,30-31H2,1-2H3/t40-/m1/s1 |
| InChIKey | UKMGDEPADXLYMW-RRHRGVEJSA-N |
| XLogP | 7.15 |
| TPSA | 105.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.83 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|