C31H36N4O8 — CID 123859113
(2,4-dimethoxyphenyl)methyl 3-[4-(benzotriazol-1-yloxymethoxy)phenyl]-2-(2-methylbutan-2-yloxycarbonylamino)propanoate (PubChem CID 123859113) has the molecular formula C31H36N4O8 and a molecular weight of 592.65 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)methyl 3-[4-(benzotriazol-1-yloxymethoxy)phenyl]-2-(2-methylbutan-2-yloxycarbonylamino)propanoate.
| Compound Name | (2,4-dimethoxyphenyl)methyl 3-[4-(benzotriazol-1-yloxymethoxy)phenyl]-2-(2-methylbutan-2-yloxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 123859113 |
| Molecular Formula | C31H36N4O8 |
| Molecular Weight | 592.65 g/mol |
| Exact Mass | 592.25 |
| IUPAC Name | (2,4-dimethoxyphenyl)methyl 3-[4-(benzotriazol-1-yloxymethoxy)phenyl]-2-(2-methylbutan-2-yloxycarbonylamino)propanoate |
| SMILES | CCC(C)(C)OC(=O)NC(Cc1ccc(OCOn2nnc3ccccc32)cc1)C(=O)OCc1ccc(OC)cc1OC |
| InChI | InChI=1S/C31H36N4O8/c1-6-31(2,3)43-30(37)32-26(29(36)40-19-22-13-16-24(38-4)18-28(22)39-5)17-21-11-14-23(15-12-21)41-20-42-35-27-10-8-7-9-25(27)33-34-35/h7-16,18,26H,6,17,19-20H2,1-5H3,(H,32,37) |
| InChIKey | ZDHMMPUFRXANTG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 132.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.65 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|