C28H33N5O8 — CID 71476310
dicyclopropylmethyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-[(6-nitrobenzotriazol-1-yl)oxymethoxy]phenyl]propanoate (PubChem CID 71476310) has the molecular formula C28H33N5O8 and a molecular weight of 567.60 g/mol. Its IUPAC name is dicyclopropylmethyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-[(6-nitrobenzotriazol-1-yl)oxymethoxy]phenyl]propanoate.
| Compound Name | dicyclopropylmethyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-[(6-nitrobenzotriazol-1-yl)oxymethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 71476310 |
| Molecular Formula | C28H33N5O8 |
| Molecular Weight | 567.60 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | dicyclopropylmethyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-[(6-nitrobenzotriazol-1-yl)oxymethoxy]phenyl]propanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(OCOn2nnc3ccc([N+](=O)[O-])cc32)cc1)C(=O)OC(C1CC1)C1CC1 |
| InChI | InChI=1S/C28H33N5O8/c1-28(2,3)41-27(35)29-23(26(34)40-25(18-6-7-18)19-8-9-19)14-17-4-11-21(12-5-17)38-16-39-32-24-15-20(33(36)37)10-13-22(24)30-31-32/h4-5,10-13,15,18-19,23,25H,6-9,14,16H2,1-3H3,(H,29,35)/t23-/m0/s1 |
| InChIKey | SAOVMCFTSKYABE-QHCPKHFHSA-N |
| XLogP | 3.97 |
| TPSA | 156.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.60 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|