C19H25N5O6S — CID 10789764
tert-butyl (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(6-nitrobenzotriazol-1-yl)-4-sulfanylidenebutanoate (PubChem CID 10789764) has the molecular formula C19H25N5O6S and a molecular weight of 451.51 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(6-nitrobenzotriazol-1-yl)-4-sulfanylidenebutanoate.
| Compound Name | tert-butyl (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(6-nitrobenzotriazol-1-yl)-4-sulfanylidenebutanoate |
|---|---|
| PubChem CID | 10789764 |
| Molecular Formula | C19H25N5O6S |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | tert-butyl (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(6-nitrobenzotriazol-1-yl)-4-sulfanylidenebutanoate |
| SMILES | CC(C)(C)OC(=O)C[C@H](NC(=O)OC(C)(C)C)C(=S)n1nnc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C19H25N5O6S/c1-18(2,3)29-15(25)10-13(20-17(26)30-19(4,5)6)16(31)23-14-9-11(24(27)28)7-8-12(14)21-22-23/h7-9,13H,10H2,1-6H3,(H,20,26)/t13-/m0/s1 |
| InChIKey | OBDRGXNDANSXPH-ZDUSSCGKSA-N |
| XLogP | 3.14 |
| TPSA | 138.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|