C19H26N4O6 — CID 175541003
ethyl 4-(1-methyl-5-nitrobenzimidazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 175541003) has the molecular formula C19H26N4O6 and a molecular weight of 406.44 g/mol. Its IUPAC name is ethyl 4-(1-methyl-5-nitrobenzimidazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | ethyl 4-(1-methyl-5-nitrobenzimidazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 175541003 |
| Molecular Formula | C19H26N4O6 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | ethyl 4-(1-methyl-5-nitrobenzimidazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CCOC(=O)C(CCc1nc2cc([N+](=O)[O-])ccc2n1C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H26N4O6/c1-6-28-17(24)13(21-18(25)29-19(2,3)4)8-10-16-20-14-11-12(23(26)27)7-9-15(14)22(16)5/h7,9,11,13H,6,8,10H2,1-5H3,(H,21,25) |
| InChIKey | VQSFOORYMQOSKS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|