C22H26N2O6 — CID 11122540
ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(3-nitrophenyl)phenyl]propanoate (PubChem CID 11122540) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(3-nitrophenyl)phenyl]propanoate.
| Compound Name | ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(3-nitrophenyl)phenyl]propanoate |
|---|---|
| PubChem CID | 11122540 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(3-nitrophenyl)phenyl]propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(-c2cccc([N+](=O)[O-])c2)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H26N2O6/c1-5-29-20(25)19(23-21(26)30-22(2,3)4)13-15-9-11-16(12-10-15)17-7-6-8-18(14-17)24(27)28/h6-12,14,19H,5,13H2,1-4H3,(H,23,26) |
| InChIKey | UVPDAKRXLSDUSE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|