C23H33N5O7 — CID 171477623
ethyl (2S)-3-methyl-2-[[(2S)-3-(1-methyl-5-nitrobenzimidazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]butanoate (PubChem CID 171477623) has the molecular formula C23H33N5O7 and a molecular weight of 491.55 g/mol. Its IUPAC name is ethyl (2S)-3-methyl-2-[[(2S)-3-(1-methyl-5-nitrobenzimidazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]butanoate.
| Compound Name | ethyl (2S)-3-methyl-2-[[(2S)-3-(1-methyl-5-nitrobenzimidazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]butanoate |
|---|---|
| PubChem CID | 171477623 |
| Molecular Formula | C23H33N5O7 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | ethyl (2S)-3-methyl-2-[[(2S)-3-(1-methyl-5-nitrobenzimidazol-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]butanoate |
| SMILES | CCOC(=O)[C@@H](NC(=O)[C@H](Cc1nc2cc([N+](=O)[O-])ccc2n1C)NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C23H33N5O7/c1-8-34-21(30)19(13(2)3)26-20(29)16(25-22(31)35-23(4,5)6)12-18-24-15-11-14(28(32)33)9-10-17(15)27(18)7/h9-11,13,16,19H,8,12H2,1-7H3,(H,25,31)(H,26,29)/t16-,19-/m0/s1 |
| InChIKey | DLTRWGPRAAFVRU-LPHOPBHVSA-N |
| XLogP | 2.62 |
| TPSA | 154.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|