C43H43N5O6 — CID 86620533
tert-butyl N-[(2S)-4-[5,6-dimethyl-1-(3-nitrophenyl)benzimidazol-2-yl]-1-oxo-1-(trityloxyamino)butan-2-yl]carbamate (PubChem CID 86620533) has the molecular formula C43H43N5O6 and a molecular weight of 725.85 g/mol. Its IUPAC name is tert-butyl N-[(2S)-4-[5,6-dimethyl-1-(3-nitrophenyl)benzimidazol-2-yl]-1-oxo-1-(trityloxyamino)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-4-[5,6-dimethyl-1-(3-nitrophenyl)benzimidazol-2-yl]-1-oxo-1-(trityloxyamino)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 86620533 |
| Molecular Formula | C43H43N5O6 |
| Molecular Weight | 725.85 g/mol |
| Exact Mass | 725.32 |
| IUPAC Name | tert-butyl N-[(2S)-4-[5,6-dimethyl-1-(3-nitrophenyl)benzimidazol-2-yl]-1-oxo-1-(trityloxyamino)butan-2-yl]carbamate |
| SMILES | Cc1cc2nc(CC[C@H](NC(=O)OC(C)(C)C)C(=O)NOC(c3ccccc3)(c3ccccc3)c3ccccc3)n(-c3cccc([N+](=O)[O-])c3)c2cc1C |
| InChI | InChI=1S/C43H43N5O6/c1-29-26-37-38(27-30(29)2)47(34-22-15-23-35(28-34)48(51)52)39(44-37)25-24-36(45-41(50)53-42(3,4)5)40(49)46-54-43(31-16-9-6-10-17-31,32-18-11-7-12-19-32)33-20-13-8-14-21-33/h6-23,26-28,36H,24-25H2,1-5H3,(H,45,50)(H,46,49)/t36-/m0/s1 |
| InChIKey | RKRSTWJOEMQUMO-BHVANESWSA-N |
| XLogP | 8.42 |
| TPSA | 137.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.85 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|