C44H52N4O4 — CID 86620526
tert-butyl N-[(2R)-4-[1-(cyclohexylmethyl)-5,6-dimethylbenzimidazol-2-yl]-1-oxo-1-(trityloxyamino)butan-2-yl]carbamate (PubChem CID 86620526) has the molecular formula C44H52N4O4 and a molecular weight of 700.92 g/mol. Its IUPAC name is tert-butyl N-[(2R)-4-[1-(cyclohexylmethyl)-5,6-dimethylbenzimidazol-2-yl]-1-oxo-1-(trityloxyamino)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-4-[1-(cyclohexylmethyl)-5,6-dimethylbenzimidazol-2-yl]-1-oxo-1-(trityloxyamino)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 86620526 |
| Molecular Formula | C44H52N4O4 |
| Molecular Weight | 700.92 g/mol |
| Exact Mass | 700.40 |
| IUPAC Name | tert-butyl N-[(2R)-4-[1-(cyclohexylmethyl)-5,6-dimethylbenzimidazol-2-yl]-1-oxo-1-(trityloxyamino)butan-2-yl]carbamate |
| SMILES | Cc1cc2nc(CC[C@@H](NC(=O)OC(C)(C)C)C(=O)NOC(c3ccccc3)(c3ccccc3)c3ccccc3)n(CC3CCCCC3)c2cc1C |
| InChI | InChI=1S/C44H52N4O4/c1-31-28-38-39(29-32(31)2)48(30-33-18-10-6-11-19-33)40(45-38)27-26-37(46-42(50)51-43(3,4)5)41(49)47-52-44(34-20-12-7-13-21-34,35-22-14-8-15-23-35)36-24-16-9-17-25-36/h7-9,12-17,20-25,28-29,33,37H,6,10-11,18-19,26-27,30H2,1-5H3,(H,46,50)(H,47,49)/t37-/m1/s1 |
| InChIKey | VPCFAJMNNIURPR-DIPNUNPCSA-N |
| XLogP | 9.10 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.92 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|