C33H46N4O4 — CID 87750224
tert-butyl (2S)-2-cyclohexyl-2-[[1-oxo-1-(phenylmethoxyamino)-4-(1-propylbenzimidazol-2-yl)butan-2-yl]amino]acetate (PubChem CID 87750224) has the molecular formula C33H46N4O4 and a molecular weight of 562.76 g/mol. Its IUPAC name is tert-butyl (2S)-2-cyclohexyl-2-[[1-oxo-1-(phenylmethoxyamino)-4-(1-propylbenzimidazol-2-yl)butan-2-yl]amino]acetate.
| Compound Name | tert-butyl (2S)-2-cyclohexyl-2-[[1-oxo-1-(phenylmethoxyamino)-4-(1-propylbenzimidazol-2-yl)butan-2-yl]amino]acetate |
|---|---|
| PubChem CID | 87750224 |
| Molecular Formula | C33H46N4O4 |
| Molecular Weight | 562.76 g/mol |
| Exact Mass | 562.35 |
| IUPAC Name | tert-butyl (2S)-2-cyclohexyl-2-[[1-oxo-1-(phenylmethoxyamino)-4-(1-propylbenzimidazol-2-yl)butan-2-yl]amino]acetate |
| SMILES | CCCn1c(CCC(N[C@H](C(=O)OC(C)(C)C)C2CCCCC2)C(=O)NOCc2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C33H46N4O4/c1-5-22-37-28-19-13-12-18-26(28)34-29(37)21-20-27(31(38)36-40-23-24-14-8-6-9-15-24)35-30(25-16-10-7-11-17-25)32(39)41-33(2,3)4/h6,8-9,12-15,18-19,25,27,30,35H,5,7,10-11,16-17,20-23H2,1-4H3,(H,36,38)/t27?,30-/m0/s1 |
| InChIKey | YFAMKLIYXFEPSW-MILIPEGGSA-N |
| XLogP | 5.88 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.76 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|