C32H46N4O4 — CID 86620502
tert-butyl N-[(2S)-4-(1-methylbenzimidazol-2-yl)-1-oxo-1-(phenylmethoxyamino)butan-2-yl]-N-octylcarbamate (PubChem CID 86620502) has the molecular formula C32H46N4O4 and a molecular weight of 550.74 g/mol. Its IUPAC name is tert-butyl N-[(2S)-4-(1-methylbenzimidazol-2-yl)-1-oxo-1-(phenylmethoxyamino)butan-2-yl]-N-octylcarbamate.
| Compound Name | tert-butyl N-[(2S)-4-(1-methylbenzimidazol-2-yl)-1-oxo-1-(phenylmethoxyamino)butan-2-yl]-N-octylcarbamate |
|---|---|
| PubChem CID | 86620502 |
| Molecular Formula | C32H46N4O4 |
| Molecular Weight | 550.74 g/mol |
| Exact Mass | 550.35 |
| IUPAC Name | tert-butyl N-[(2S)-4-(1-methylbenzimidazol-2-yl)-1-oxo-1-(phenylmethoxyamino)butan-2-yl]-N-octylcarbamate |
| SMILES | CCCCCCCCN(C(=O)OC(C)(C)C)[C@@H](CCc1nc2ccccc2n1C)C(=O)NOCc1ccccc1 |
| InChI | InChI=1S/C32H46N4O4/c1-6-7-8-9-10-16-23-36(31(38)40-32(2,3)4)28(30(37)34-39-24-25-17-12-11-13-18-25)21-22-29-33-26-19-14-15-20-27(26)35(29)5/h11-15,17-20,28H,6-10,16,21-24H2,1-5H3,(H,34,37)/t28-/m0/s1 |
| InChIKey | BVOFFGYMNQSIDD-NDEPHWFRSA-N |
| XLogP | 6.72 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.74 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|