C20H29N3O4 — CID 69246399
(2S)-4-(1-methylbenzimidazol-2-yl)-2-[[4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]amino]butanoic acid (PubChem CID 69246399) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is (2S)-4-(1-methylbenzimidazol-2-yl)-2-[[4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]amino]butanoic acid.
| Compound Name | (2S)-4-(1-methylbenzimidazol-2-yl)-2-[[4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]amino]butanoic acid |
|---|---|
| PubChem CID | 69246399 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | (2S)-4-(1-methylbenzimidazol-2-yl)-2-[[4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]amino]butanoic acid |
| SMILES | Cn1c(CC[C@H](NCCCC(=O)OC(C)(C)C)C(=O)O)nc2ccccc21 |
| InChI | InChI=1S/C20H29N3O4/c1-20(2,3)27-18(24)10-7-13-21-15(19(25)26)11-12-17-22-14-8-5-6-9-16(14)23(17)4/h5-6,8-9,15,21H,7,10-13H2,1-4H3,(H,25,26)/t15-/m0/s1 |
| InChIKey | PAWSLODMSWUCHW-HNNXBMFYSA-N |
| XLogP | 2.67 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|