C17H26N4O2 — CID 107247403
tert-butyl N-[1-[(1-methylbenzimidazol-2-yl)methylamino]propan-2-yl]carbamate (PubChem CID 107247403) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is tert-butyl N-[1-[(1-methylbenzimidazol-2-yl)methylamino]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(1-methylbenzimidazol-2-yl)methylamino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 107247403 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | tert-butyl N-[1-[(1-methylbenzimidazol-2-yl)methylamino]propan-2-yl]carbamate |
| SMILES | CC(CNCc1nc2ccccc2n1C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H26N4O2/c1-12(19-16(22)23-17(2,3)4)10-18-11-15-20-13-8-6-7-9-14(13)21(15)5/h6-9,12,18H,10-11H2,1-5H3,(H,19,22) |
| InChIKey | MJEFEBGVGDKICZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |