C12H17N3O2 — CID 66176732
3-[(1-methylbenzimidazol-2-yl)methylamino]propane-1,2-diol (PubChem CID 66176732) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 3-[(1-methylbenzimidazol-2-yl)methylamino]propane-1,2-diol.
| Compound Name | 3-[(1-methylbenzimidazol-2-yl)methylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 66176732 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 3-[(1-methylbenzimidazol-2-yl)methylamino]propane-1,2-diol |
| SMILES | Cn1c(CNCC(O)CO)nc2ccccc21 |
| InChI | InChI=1S/C12H17N3O2/c1-15-11-5-3-2-4-10(11)14-12(15)7-13-6-9(17)8-16/h2-5,9,13,16-17H,6-8H2,1H3 |
| InChIKey | RUQXBNYWFPCNPX-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |