C23H31N3O3 — CID 123173626
tert-butyl N-[1-[(3-carbazol-9-yl-2-hydroxypropyl)amino]propan-2-yl]carbamate (PubChem CID 123173626) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is tert-butyl N-[1-[(3-carbazol-9-yl-2-hydroxypropyl)amino]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(3-carbazol-9-yl-2-hydroxypropyl)amino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 123173626 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | tert-butyl N-[1-[(3-carbazol-9-yl-2-hydroxypropyl)amino]propan-2-yl]carbamate |
| SMILES | CC(CNCC(O)Cn1c2ccccc2c2ccccc21)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H31N3O3/c1-16(25-22(28)29-23(2,3)4)13-24-14-17(27)15-26-20-11-7-5-9-18(20)19-10-6-8-12-21(19)26/h5-12,16-17,24,27H,13-15H2,1-4H3,(H,25,28) |
| InChIKey | JLZFDOQEDKTRDH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |