C21H28N2O2 — CID 154741332
3-[(3-carbazol-9-yl-2-hydroxypropyl)amino]-2,3-dimethylbutan-2-ol (PubChem CID 154741332) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 3-[(3-carbazol-9-yl-2-hydroxypropyl)amino]-2,3-dimethylbutan-2-ol.
| Compound Name | 3-[(3-carbazol-9-yl-2-hydroxypropyl)amino]-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 154741332 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 3-[(3-carbazol-9-yl-2-hydroxypropyl)amino]-2,3-dimethylbutan-2-ol |
| SMILES | CC(C)(O)C(C)(C)NCC(O)Cn1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C21H28N2O2/c1-20(2,21(3,4)25)22-13-15(24)14-23-18-11-7-5-9-16(18)17-10-6-8-12-19(17)23/h5-12,15,22,24-25H,13-14H2,1-4H3 |
| InChIKey | QOSVGVVGFNWXBU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |