C19H22Cl2N2O — CID 2802133
1-(tert-butylamino)-3-(3,6-dichlorocarbazol-9-yl)propan-2-ol (PubChem CID 2802133) has the molecular formula C19H22Cl2N2O and a molecular weight of 365.30 g/mol. Its IUPAC name is 1-(tert-butylamino)-3-(3,6-dichlorocarbazol-9-yl)propan-2-ol.
| Compound Name | 1-(tert-butylamino)-3-(3,6-dichlorocarbazol-9-yl)propan-2-ol |
|---|---|
| PubChem CID | 2802133 |
| Molecular Formula | C19H22Cl2N2O |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 1-(tert-butylamino)-3-(3,6-dichlorocarbazol-9-yl)propan-2-ol |
| SMILES | CC(C)(C)NCC(O)Cn1c2ccc(Cl)cc2c2cc(Cl)ccc21 |
| InChI | InChI=1S/C19H22Cl2N2O/c1-19(2,3)22-10-14(24)11-23-17-6-4-12(20)8-15(17)16-9-13(21)5-7-18(16)23/h4-9,14,22,24H,10-11H2,1-3H3 |
| InChIKey | PAESBFXBNGSCDM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |