C23H22Cl2N2O — CID 3962134
1-(3,6-dichlorocarbazol-9-yl)-3-(2-phenylethylamino)propan-2-ol (PubChem CID 3962134) has the molecular formula C23H22Cl2N2O and a molecular weight of 413.35 g/mol. Its IUPAC name is 1-(3,6-dichlorocarbazol-9-yl)-3-(2-phenylethylamino)propan-2-ol.
| Compound Name | 1-(3,6-dichlorocarbazol-9-yl)-3-(2-phenylethylamino)propan-2-ol |
|---|---|
| PubChem CID | 3962134 |
| Molecular Formula | C23H22Cl2N2O |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 1-(3,6-dichlorocarbazol-9-yl)-3-(2-phenylethylamino)propan-2-ol |
| SMILES | OC(CNCCc1ccccc1)Cn1c2ccc(Cl)cc2c2cc(Cl)ccc21 |
| InChI | InChI=1S/C23H22Cl2N2O/c24-17-6-8-22-20(12-17)21-13-18(25)7-9-23(21)27(22)15-19(28)14-26-11-10-16-4-2-1-3-5-16/h1-9,12-13,19,26,28H,10-11,14-15H2 |
| InChIKey | MAVZDIQQAYQMET-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|