C23H22Cl2N2O — CID 1050322
(2S)-1-(3,6-dichlorocarbazol-9-yl)-3-(2,4-dimethylanilino)propan-2-ol (PubChem CID 1050322) has the molecular formula C23H22Cl2N2O and a molecular weight of 413.35 g/mol. Its IUPAC name is (2S)-1-(3,6-dichlorocarbazol-9-yl)-3-(2,4-dimethylanilino)propan-2-ol.
| Compound Name | (2S)-1-(3,6-dichlorocarbazol-9-yl)-3-(2,4-dimethylanilino)propan-2-ol |
|---|---|
| PubChem CID | 1050322 |
| Molecular Formula | C23H22Cl2N2O |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | (2S)-1-(3,6-dichlorocarbazol-9-yl)-3-(2,4-dimethylanilino)propan-2-ol |
| SMILES | Cc1ccc(NC[C@H](O)Cn2c3ccc(Cl)cc3c3cc(Cl)ccc32)c(C)c1 |
| InChI | InChI=1S/C23H22Cl2N2O/c1-14-3-6-21(15(2)9-14)26-12-18(28)13-27-22-7-4-16(24)10-19(22)20-11-17(25)5-8-23(20)27/h3-11,18,26,28H,12-13H2,1-2H3/t18-/m0/s1 |
| InChIKey | ARKCEZWOBWBMPC-SFHVURJKSA-N |
| XLogP | 6.19 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |