C21H26N2O — CID 2896665
1-(2,5-dimethylanilino)-3-(2,3-dimethylindol-1-yl)propan-2-ol (PubChem CID 2896665) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-(2,5-dimethylanilino)-3-(2,3-dimethylindol-1-yl)propan-2-ol.
| Compound Name | 1-(2,5-dimethylanilino)-3-(2,3-dimethylindol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 2896665 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 1-(2,5-dimethylanilino)-3-(2,3-dimethylindol-1-yl)propan-2-ol |
| SMILES | Cc1ccc(C)c(NCC(O)Cn2c(C)c(C)c3ccccc32)c1 |
| InChI | InChI=1S/C21H26N2O/c1-14-9-10-15(2)20(11-14)22-12-18(24)13-23-17(4)16(3)19-7-5-6-8-21(19)23/h5-11,18,22,24H,12-13H2,1-4H3 |
| InChIKey | PPGLIDDMFSTLOC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|