C20H24N2O2 — CID 703578
(2S)-1-(2,3-dimethylindol-1-yl)-3-(2-methoxyanilino)propan-2-ol (PubChem CID 703578) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is (2S)-1-(2,3-dimethylindol-1-yl)-3-(2-methoxyanilino)propan-2-ol.
| Compound Name | (2S)-1-(2,3-dimethylindol-1-yl)-3-(2-methoxyanilino)propan-2-ol |
|---|---|
| PubChem CID | 703578 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (2S)-1-(2,3-dimethylindol-1-yl)-3-(2-methoxyanilino)propan-2-ol |
| SMILES | COc1ccccc1NC[C@H](O)Cn1c(C)c(C)c2ccccc21 |
| InChI | InChI=1S/C20H24N2O2/c1-14-15(2)22(19-10-6-4-8-17(14)19)13-16(23)12-21-18-9-5-7-11-20(18)24-3/h4-11,16,21,23H,12-13H2,1-3H3/t16-/m0/s1 |
| InChIKey | GXPIDCYQIWSJAK-INIZCTEOSA-N |
| XLogP | 3.74 |
| TPSA | 46.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_OC_alk_E(1)', 'substructure': 'N/A'} |
|---|