C19H21NO2S — CID 70694767
2-[3-(2,3-dimethylindol-1-yl)-2-hydroxypropyl]sulfanylphenol (PubChem CID 70694767) has the molecular formula C19H21NO2S and a molecular weight of 327.45 g/mol. Its IUPAC name is 2-[3-(2,3-dimethylindol-1-yl)-2-hydroxypropyl]sulfanylphenol.
| Compound Name | 2-[3-(2,3-dimethylindol-1-yl)-2-hydroxypropyl]sulfanylphenol |
|---|---|
| PubChem CID | 70694767 |
| Molecular Formula | C19H21NO2S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 2-[3-(2,3-dimethylindol-1-yl)-2-hydroxypropyl]sulfanylphenol |
| SMILES | Cc1c(C)n(CC(O)CSc2ccccc2O)c2ccccc12 |
| InChI | InChI=1S/C19H21NO2S/c1-13-14(2)20(17-8-4-3-7-16(13)17)11-15(21)12-23-19-10-6-5-9-18(19)22/h3-10,15,21-22H,11-12H2,1-2H3 |
| InChIKey | FGXUPLBTGJHVGS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|