C19H29N3O2 — CID 3151627
1-(2,3-dimethylindol-1-yl)-3-[4-(2-hydroxyethyl)piperazin-1-yl]propan-2-ol (PubChem CID 3151627) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 1-(2,3-dimethylindol-1-yl)-3-[4-(2-hydroxyethyl)piperazin-1-yl]propan-2-ol.
| Compound Name | 1-(2,3-dimethylindol-1-yl)-3-[4-(2-hydroxyethyl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 3151627 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 1-(2,3-dimethylindol-1-yl)-3-[4-(2-hydroxyethyl)piperazin-1-yl]propan-2-ol |
| SMILES | Cc1c(C)n(CC(O)CN2CCN(CCO)CC2)c2ccccc12 |
| InChI | InChI=1S/C19H29N3O2/c1-15-16(2)22(19-6-4-3-5-18(15)19)14-17(24)13-21-9-7-20(8-10-21)11-12-23/h3-6,17,23-24H,7-14H2,1-2H3 |
| InChIKey | XFEOYDJUGMDZNQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 51.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|