C20H31N3O2 — CID 1089151
(2R)-1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-(2,3,5-trimethylindol-1-yl)propan-2-ol (PubChem CID 1089151) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is (2R)-1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-(2,3,5-trimethylindol-1-yl)propan-2-ol.
| Compound Name | (2R)-1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-(2,3,5-trimethylindol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 1089151 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | (2R)-1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-(2,3,5-trimethylindol-1-yl)propan-2-ol |
| SMILES | Cc1ccc2c(c1)c(C)c(C)n2C[C@H](O)CN1CCN(CCO)CC1 |
| InChI | InChI=1S/C20H31N3O2/c1-15-4-5-20-19(12-15)16(2)17(3)23(20)14-18(25)13-22-8-6-21(7-9-22)10-11-24/h4-5,12,18,24-25H,6-11,13-14H2,1-3H3/t18-/m1/s1 |
| InChIKey | ZZLBEVSEZMEJBB-GOSISDBHSA-N |
| XLogP | 1.54 |
| TPSA | 51.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|