C19H28N2O — CID 5235423
1-piperidin-1-yl-3-(2,3,5-trimethylindol-1-yl)propan-2-ol (PubChem CID 5235423) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is 1-piperidin-1-yl-3-(2,3,5-trimethylindol-1-yl)propan-2-ol.
| Compound Name | 1-piperidin-1-yl-3-(2,3,5-trimethylindol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 5235423 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | 1-piperidin-1-yl-3-(2,3,5-trimethylindol-1-yl)propan-2-ol |
| SMILES | Cc1ccc2c(c1)c(C)c(C)n2CC(O)CN1CCCCC1 |
| InChI | InChI=1S/C19H28N2O/c1-14-7-8-19-18(11-14)15(2)16(3)21(19)13-17(22)12-20-9-5-4-6-10-20/h7-8,11,17,22H,4-6,9-10,12-13H2,1-3H3 |
| InChIKey | QFJLVIBQTRNFGH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|