C19H28N2O — CID 35583838
(2R)-1-(cyclopentylamino)-3-(2,3,5-trimethylindol-1-yl)propan-2-ol (PubChem CID 35583838) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is (2R)-1-(cyclopentylamino)-3-(2,3,5-trimethylindol-1-yl)propan-2-ol.
| Compound Name | (2R)-1-(cyclopentylamino)-3-(2,3,5-trimethylindol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 35583838 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | (2R)-1-(cyclopentylamino)-3-(2,3,5-trimethylindol-1-yl)propan-2-ol |
| SMILES | Cc1ccc2c(c1)c(C)c(C)n2C[C@H](O)CNC1CCCC1 |
| InChI | InChI=1S/C19H28N2O/c1-13-8-9-19-18(10-13)14(2)15(3)21(19)12-17(22)11-20-16-6-4-5-7-16/h8-10,16-17,20,22H,4-7,11-12H2,1-3H3/t17-/m1/s1 |
| InChIKey | BTCPRWRCAYLSNL-QGZVFWFLSA-N |
| XLogP | 3.46 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|