C21H26N2O — CID 3635534
1-(2,3-dimethylindol-1-yl)-3-(2-phenylethylamino)propan-2-ol (PubChem CID 3635534) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-(2,3-dimethylindol-1-yl)-3-(2-phenylethylamino)propan-2-ol.
| Compound Name | 1-(2,3-dimethylindol-1-yl)-3-(2-phenylethylamino)propan-2-ol |
|---|---|
| PubChem CID | 3635534 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 1-(2,3-dimethylindol-1-yl)-3-(2-phenylethylamino)propan-2-ol |
| SMILES | Cc1c(C)n(CC(O)CNCCc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C21H26N2O/c1-16-17(2)23(21-11-7-6-10-20(16)21)15-19(24)14-22-13-12-18-8-4-3-5-9-18/h3-11,19,22,24H,12-15H2,1-2H3 |
| InChIKey | UYEBZMBMRMWPHP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|