C23H24ClN2O- — CID 21235133
1-(2,3-dimethylindol-1-yl)-3-(naphthalen-1-ylamino)propan-2-ol chloride (PubChem CID 21235133) has the molecular formula C23H24ClN2O- and a molecular weight of 379.91 g/mol. Its IUPAC name is 1-(2,3-dimethylindol-1-yl)-3-(naphthalen-1-ylamino)propan-2-ol chloride.
| Compound Name | 1-(2,3-dimethylindol-1-yl)-3-(naphthalen-1-ylamino)propan-2-ol chloride |
|---|---|
| PubChem CID | 21235133 |
| Molecular Formula | C23H24ClN2O- |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 1-(2,3-dimethylindol-1-yl)-3-(naphthalen-1-ylamino)propan-2-ol chloride |
| SMILES | Cc1c(C)n(CC(O)CNc2cccc3ccccc23)c2ccccc12.[Cl-] |
| InChI | InChI=1S/C23H24N2O.ClH/c1-16-17(2)25(23-13-6-5-10-20(16)23)15-19(26)14-24-22-12-7-9-18-8-3-4-11-21(18)22;/h3-13,19,24,26H,14-15H2,1-2H3;1H/p-1 |
| InChIKey | FNWDVSDRWLILBN-UHFFFAOYSA-M |
| XLogP | 1.89 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|