C18H22BrN3O — CID 7110489
(2R)-1-(4-bromo-3,5-dimethylpyrazol-1-yl)-3-(2,3-dimethylindol-1-yl)propan-2-ol (PubChem CID 7110489) has the molecular formula C18H22BrN3O and a molecular weight of 376.30 g/mol. Its IUPAC name is (2R)-1-(4-bromo-3,5-dimethylpyrazol-1-yl)-3-(2,3-dimethylindol-1-yl)propan-2-ol.
| Compound Name | (2R)-1-(4-bromo-3,5-dimethylpyrazol-1-yl)-3-(2,3-dimethylindol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 7110489 |
| Molecular Formula | C18H22BrN3O |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | (2R)-1-(4-bromo-3,5-dimethylpyrazol-1-yl)-3-(2,3-dimethylindol-1-yl)propan-2-ol |
| SMILES | Cc1nn(C[C@H](O)Cn2c(C)c(C)c3ccccc32)c(C)c1Br |
| InChI | InChI=1S/C18H22BrN3O/c1-11-13(3)21(17-8-6-5-7-16(11)17)9-15(23)10-22-14(4)18(19)12(2)20-22/h5-8,15,23H,9-10H2,1-4H3/t15-/m1/s1 |
| InChIKey | GAGJAHQNKGFUGK-OAHLLOKOSA-N |
| XLogP | 3.90 |
| TPSA | 42.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|