C19H23Cl2N2O+ — CID 7478117
[(2S)-butan-2-yl]-[(2R)-3-(3,6-dichlorocarbazol-9-yl)-2-hydroxypropyl]azanium (PubChem CID 7478117) has the molecular formula C19H23Cl2N2O+ and a molecular weight of 366.31 g/mol. Its IUPAC name is [(2S)-butan-2-yl]-[(2R)-3-(3,6-dichlorocarbazol-9-yl)-2-hydroxypropyl]azanium.
| Compound Name | [(2S)-butan-2-yl]-[(2R)-3-(3,6-dichlorocarbazol-9-yl)-2-hydroxypropyl]azanium |
|---|---|
| PubChem CID | 7478117 |
| Molecular Formula | C19H23Cl2N2O+ |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | [(2S)-butan-2-yl]-[(2R)-3-(3,6-dichlorocarbazol-9-yl)-2-hydroxypropyl]azanium |
| SMILES | CC[C@H](C)[NH2+]C[C@@H](O)Cn1c2ccc(Cl)cc2c2cc(Cl)ccc21 |
| InChI | InChI=1S/C19H22Cl2N2O/c1-3-12(2)22-10-15(24)11-23-18-6-4-13(20)8-16(18)17-9-14(21)5-7-19(17)23/h4-9,12,15,22,24H,3,10-11H2,1-2H3/p+1/t12-,15+/m0/s1 |
| InChIKey | CRSBMRJNJIXPFW-SWLSCSKDSA-O |
| XLogP | 3.82 |
| TPSA | 41.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |