C21H27Cl2N2O+ — CID 7177141
[(2R)-3-(3,6-dichlorocarbazol-9-yl)-2-hydroxypropyl]-dipropylazanium (PubChem CID 7177141) has the molecular formula C21H27Cl2N2O+ and a molecular weight of 394.37 g/mol. Its IUPAC name is [(2R)-3-(3,6-dichlorocarbazol-9-yl)-2-hydroxypropyl]-dipropylazanium.
| Compound Name | [(2R)-3-(3,6-dichlorocarbazol-9-yl)-2-hydroxypropyl]-dipropylazanium |
|---|---|
| PubChem CID | 7177141 |
| Molecular Formula | C21H27Cl2N2O+ |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | [(2R)-3-(3,6-dichlorocarbazol-9-yl)-2-hydroxypropyl]-dipropylazanium |
| SMILES | CCC[NH+](CCC)C[C@H](O)Cn1c2ccc(Cl)cc2c2cc(Cl)ccc21 |
| InChI | InChI=1S/C21H26Cl2N2O/c1-3-9-24(10-4-2)13-17(26)14-25-20-7-5-15(22)11-18(20)19-12-16(23)6-8-21(19)25/h5-8,11-12,17,26H,3-4,9-10,13-14H2,1-2H3/p+1/t17-/m0/s1 |
| InChIKey | XCONKEKFERLXAP-KRWDZBQOSA-O |
| XLogP | 4.17 |
| TPSA | 29.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |