C26H27Cl2N3O — CID 35726321
(2S)-1-(3,6-dichlorocarbazol-9-yl)-3-[4-(4-methylphenyl)piperazin-1-yl]propan-2-ol (PubChem CID 35726321) has the molecular formula C26H27Cl2N3O and a molecular weight of 468.43 g/mol. Its IUPAC name is (2S)-1-(3,6-dichlorocarbazol-9-yl)-3-[4-(4-methylphenyl)piperazin-1-yl]propan-2-ol.
| Compound Name | (2S)-1-(3,6-dichlorocarbazol-9-yl)-3-[4-(4-methylphenyl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 35726321 |
| Molecular Formula | C26H27Cl2N3O |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | (2S)-1-(3,6-dichlorocarbazol-9-yl)-3-[4-(4-methylphenyl)piperazin-1-yl]propan-2-ol |
| SMILES | Cc1ccc(N2CCN(C[C@H](O)Cn3c4ccc(Cl)cc4c4cc(Cl)ccc43)CC2)cc1 |
| InChI | InChI=1S/C26H27Cl2N3O/c1-18-2-6-21(7-3-18)30-12-10-29(11-13-30)16-22(32)17-31-25-8-4-19(27)14-23(25)24-15-20(28)5-9-26(24)31/h2-9,14-15,22,32H,10-13,16-17H2,1H3/t22-/m0/s1 |
| InChIKey | DWGJRWQMICUWSN-QFIPXVFZSA-N |
| XLogP | 5.59 |
| TPSA | 31.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|