C26H27Br2N3O — CID 21234903
1-(3,6-dibromocarbazol-9-yl)-3-[4-(4-methylphenyl)piperazin-1-yl]propan-2-ol (PubChem CID 21234903) has the molecular formula C26H27Br2N3O and a molecular weight of 557.33 g/mol. Its IUPAC name is 1-(3,6-dibromocarbazol-9-yl)-3-[4-(4-methylphenyl)piperazin-1-yl]propan-2-ol.
| Compound Name | 1-(3,6-dibromocarbazol-9-yl)-3-[4-(4-methylphenyl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 21234903 |
| Molecular Formula | C26H27Br2N3O |
| Molecular Weight | 557.33 g/mol |
| Exact Mass | 555.05 |
| IUPAC Name | 1-(3,6-dibromocarbazol-9-yl)-3-[4-(4-methylphenyl)piperazin-1-yl]propan-2-ol |
| SMILES | Cc1ccc(N2CCN(CC(O)Cn3c4ccc(Br)cc4c4cc(Br)ccc43)CC2)cc1 |
| InChI | InChI=1S/C26H27Br2N3O/c1-18-2-6-21(7-3-18)30-12-10-29(11-13-30)16-22(32)17-31-25-8-4-19(27)14-23(25)24-15-20(28)5-9-26(24)31/h2-9,14-15,22,32H,10-13,16-17H2,1H3 |
| InChIKey | UNSLLAHCOQRCMB-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 31.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.33 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|