C27H35Cl2N2O+ — CID 2274367
dicyclohexyl-[(2S)-3-(3,6-dichlorocarbazol-9-yl)-2-hydroxypropyl]azanium (PubChem CID 2274367) has the molecular formula C27H35Cl2N2O+ and a molecular weight of 474.50 g/mol. Its IUPAC name is dicyclohexyl-[(2S)-3-(3,6-dichlorocarbazol-9-yl)-2-hydroxypropyl]azanium.
| Compound Name | dicyclohexyl-[(2S)-3-(3,6-dichlorocarbazol-9-yl)-2-hydroxypropyl]azanium |
|---|---|
| PubChem CID | 2274367 |
| Molecular Formula | C27H35Cl2N2O+ |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | dicyclohexyl-[(2S)-3-(3,6-dichlorocarbazol-9-yl)-2-hydroxypropyl]azanium |
| SMILES | O[C@@H](Cn1c2ccc(Cl)cc2c2cc(Cl)ccc21)C[NH+](C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C27H34Cl2N2O/c28-19-11-13-26-24(15-19)25-16-20(29)12-14-27(25)31(26)18-23(32)17-30(21-7-3-1-4-8-21)22-9-5-2-6-10-22/h11-16,21-23,32H,1-10,17-18H2/p+1/t23-/m1/s1 |
| InChIKey | SONAJUSNYFELMA-HSZRJFAPSA-O |
| XLogP | 6.01 |
| TPSA | 29.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |