C20H18Cl2N2O2 — CID 123728166
1-[3-(3,6-dichlorocarbazol-9-yl)-2-methylpropyl]pyrrole-2,5-diol (PubChem CID 123728166) has the molecular formula C20H18Cl2N2O2 and a molecular weight of 389.28 g/mol. Its IUPAC name is 1-[3-(3,6-dichlorocarbazol-9-yl)-2-methylpropyl]pyrrole-2,5-diol.
| Compound Name | 1-[3-(3,6-dichlorocarbazol-9-yl)-2-methylpropyl]pyrrole-2,5-diol |
|---|---|
| PubChem CID | 123728166 |
| Molecular Formula | C20H18Cl2N2O2 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 1-[3-(3,6-dichlorocarbazol-9-yl)-2-methylpropyl]pyrrole-2,5-diol |
| SMILES | CC(Cn1c(O)ccc1O)Cn1c2ccc(Cl)cc2c2cc(Cl)ccc21 |
| InChI | InChI=1S/C20H18Cl2N2O2/c1-12(11-24-19(25)6-7-20(24)26)10-23-17-4-2-13(21)8-15(17)16-9-14(22)3-5-18(16)23/h2-9,12,25-26H,10-11H2,1H3 |
| InChIKey | QYACTFVZOGAIJG-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |