C12H13ClN2O3 — CID 117262430
6-chloro-3-(2-hydroxypropyl)-1-methylquinazoline-2,4-dione (PubChem CID 117262430) has the molecular formula C12H13ClN2O3 and a molecular weight of 268.70 g/mol. Its IUPAC name is 6-chloro-3-(2-hydroxypropyl)-1-methylquinazoline-2,4-dione.
| Compound Name | 6-chloro-3-(2-hydroxypropyl)-1-methylquinazoline-2,4-dione |
|---|---|
| PubChem CID | 117262430 |
| Molecular Formula | C12H13ClN2O3 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 6-chloro-3-(2-hydroxypropyl)-1-methylquinazoline-2,4-dione |
| SMILES | CC(O)Cn1c(=O)c2cc(Cl)ccc2n(C)c1=O |
| InChI | InChI=1S/C12H13ClN2O3/c1-7(16)6-15-11(17)9-5-8(13)3-4-10(9)14(2)12(15)18/h3-5,7,16H,6H2,1-2H3 |
| InChIKey | AONUPYJQPLRRHD-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |