C13H16N2O3 — CID 117262422
3-(2-hydroxypropyl)-1,6-dimethylquinazoline-2,4-dione (PubChem CID 117262422) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-(2-hydroxypropyl)-1,6-dimethylquinazoline-2,4-dione.
| Compound Name | 3-(2-hydroxypropyl)-1,6-dimethylquinazoline-2,4-dione |
|---|---|
| PubChem CID | 117262422 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 3-(2-hydroxypropyl)-1,6-dimethylquinazoline-2,4-dione |
| SMILES | Cc1ccc2c(c1)c(=O)n(CC(C)O)c(=O)n2C |
| InChI | InChI=1S/C13H16N2O3/c1-8-4-5-11-10(6-8)12(17)15(7-9(2)16)13(18)14(11)3/h4-6,9,16H,7H2,1-3H3 |
| InChIKey | LLWBHCBXMDNARX-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |