C12H15N3O2 — CID 117262591
1,6-dimethyl-3-(methylaminomethyl)quinazoline-2,4-dione (PubChem CID 117262591) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 1,6-dimethyl-3-(methylaminomethyl)quinazoline-2,4-dione.
| Compound Name | 1,6-dimethyl-3-(methylaminomethyl)quinazoline-2,4-dione |
|---|---|
| PubChem CID | 117262591 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 1,6-dimethyl-3-(methylaminomethyl)quinazoline-2,4-dione |
| SMILES | CNCn1c(=O)c2cc(C)ccc2n(C)c1=O |
| InChI | InChI=1S/C12H15N3O2/c1-8-4-5-10-9(6-8)11(16)15(7-13-2)12(17)14(10)3/h4-6,13H,7H2,1-3H3 |
| InChIKey | NJNZUZRTOFZACM-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |