C24H31N3O3 — CID 149336404
tert-butyl N-[3-[[(2S)-3-carbazol-9-yl-2-hydroxypropyl]amino]-2-methylpropylidene]carbamate (PubChem CID 149336404) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is tert-butyl N-[3-[[(2S)-3-carbazol-9-yl-2-hydroxypropyl]amino]-2-methylpropylidene]carbamate.
| Compound Name | tert-butyl N-[3-[[(2S)-3-carbazol-9-yl-2-hydroxypropyl]amino]-2-methylpropylidene]carbamate |
|---|---|
| PubChem CID | 149336404 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | tert-butyl N-[3-[[(2S)-3-carbazol-9-yl-2-hydroxypropyl]amino]-2-methylpropylidene]carbamate |
| SMILES | CC(C=NC(=O)OC(C)(C)C)CNC[C@H](O)Cn1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C24H31N3O3/c1-17(14-26-23(29)30-24(2,3)4)13-25-15-18(28)16-27-21-11-7-5-9-19(21)20-10-6-8-12-22(20)27/h5-12,14,17-18,25,28H,13,15-16H2,1-4H3/t17?,18-/m0/s1 |
| InChIKey | YDIBGPQFRKIOCO-ZVAWYAOSSA-N |
| XLogP | 4.39 |
| TPSA | 75.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|