C12H20N2O2S — CID 90458389
tert-butyl N-[1-(thiophen-2-ylamino)propan-2-yl]carbamate (PubChem CID 90458389) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is tert-butyl N-[1-(thiophen-2-ylamino)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(thiophen-2-ylamino)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 90458389 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | tert-butyl N-[1-(thiophen-2-ylamino)propan-2-yl]carbamate |
| SMILES | CC(CNc1cccs1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H20N2O2S/c1-9(8-13-10-6-5-7-17-10)14-11(15)16-12(2,3)4/h5-7,9,13H,8H2,1-4H3,(H,14,15) |
| InChIKey | MMUKKYORKZQELM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |