C12H17NO4S — CID 56997717
thiophen-2-yl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 56997717) has the molecular formula C12H17NO4S and a molecular weight of 271.34 g/mol. Its IUPAC name is thiophen-2-yl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | thiophen-2-yl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 56997717 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | thiophen-2-yl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)C(=O)Oc1cccs1 |
| InChI | InChI=1S/C12H17NO4S/c1-8(13-11(15)17-12(2,3)4)10(14)16-9-6-5-7-18-9/h5-8H,1-4H3,(H,13,15)/t8-/m0/s1 |
| InChIKey | GOUWEORQCVAYST-QMMMGPOBSA-N |
| XLogP | 2.57 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |