C18H21NO4 — CID 91282149
naphthalen-1-yl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 91282149) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is naphthalen-1-yl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | naphthalen-1-yl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 91282149 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | naphthalen-1-yl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | C[C@@H](NC(=O)OC(C)(C)C)C(=O)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C18H21NO4/c1-12(19-17(21)23-18(2,3)4)16(20)22-15-11-7-9-13-8-5-6-10-14(13)15/h5-12H,1-4H3,(H,19,21)/t12-/m1/s1 |
| InChIKey | AMZGOGZUESVOIA-GFCCVEGCSA-N |
| XLogP | 3.66 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|