C22H23NO7S2 — CID 23254073
[6-(methoxycarbonyldisulfanyl)dibenzofuran-4-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 23254073) has the molecular formula C22H23NO7S2 and a molecular weight of 477.56 g/mol. Its IUPAC name is [6-(methoxycarbonyldisulfanyl)dibenzofuran-4-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | [6-(methoxycarbonyldisulfanyl)dibenzofuran-4-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 23254073 |
| Molecular Formula | C22H23NO7S2 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | [6-(methoxycarbonyldisulfanyl)dibenzofuran-4-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COC(=O)SSc1cccc2c1oc1c(OC(=O)C(C)NC(=O)OC(C)(C)C)cccc12 |
| InChI | InChI=1S/C22H23NO7S2/c1-12(23-20(25)30-22(2,3)4)19(24)28-15-10-6-8-13-14-9-7-11-16(18(14)29-17(13)15)31-32-21(26)27-5/h6-12H,1-5H3,(H,23,25) |
| InChIKey | HRPRPOYWRNPCRP-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|