C14H16Cl3NO4 — CID 13055275
(2,4,5-trichlorophenyl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 13055275) has the molecular formula C14H16Cl3NO4 and a molecular weight of 368.64 g/mol. Its IUPAC name is (2,4,5-trichlorophenyl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | (2,4,5-trichlorophenyl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 13055275 |
| Molecular Formula | C14H16Cl3NO4 |
| Molecular Weight | 368.64 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | (2,4,5-trichlorophenyl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(NC(=O)OC(C)(C)C)C(=O)Oc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H16Cl3NO4/c1-7(18-13(20)22-14(2,3)4)12(19)21-11-6-9(16)8(15)5-10(11)17/h5-7H,1-4H3,(H,18,20) |
| InChIKey | GQSWVXZEPUAZON-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.64 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|