C20H23Cl2NO6 — CID 4651493
(3,6-dichloro-4-methyl-2-oxochromen-7-yl) 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 4651493) has the molecular formula C20H23Cl2NO6 and a molecular weight of 444.31 g/mol. Its IUPAC name is (3,6-dichloro-4-methyl-2-oxochromen-7-yl) 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | (3,6-dichloro-4-methyl-2-oxochromen-7-yl) 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 4651493 |
| Molecular Formula | C20H23Cl2NO6 |
| Molecular Weight | 444.31 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | (3,6-dichloro-4-methyl-2-oxochromen-7-yl) 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | Cc1c(Cl)c(=O)oc2cc(OC(=O)C(NC(=O)OC(C)(C)C)C(C)C)c(Cl)cc12 |
| InChI | InChI=1S/C20H23Cl2NO6/c1-9(2)16(23-19(26)29-20(4,5)6)18(25)28-14-8-13-11(7-12(14)21)10(3)15(22)17(24)27-13/h7-9,16H,1-6H3,(H,23,26) |
| InChIKey | PUXGZBUVUPXDAV-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.31 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|