C23H21Cl2NO6 — CID 40829705
(3,6-dichloro-4-methyl-2-oxochromen-7-yl) (2R)-2-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 40829705) has the molecular formula C23H21Cl2NO6 and a molecular weight of 478.33 g/mol. Its IUPAC name is (3,6-dichloro-4-methyl-2-oxochromen-7-yl) (2R)-2-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | (3,6-dichloro-4-methyl-2-oxochromen-7-yl) (2R)-2-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 40829705 |
| Molecular Formula | C23H21Cl2NO6 |
| Molecular Weight | 478.33 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | (3,6-dichloro-4-methyl-2-oxochromen-7-yl) (2R)-2-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | CCC[C@@H](NC(=O)OCc1ccccc1)C(=O)Oc1cc2oc(=O)c(Cl)c(C)c2cc1Cl |
| InChI | InChI=1S/C23H21Cl2NO6/c1-3-7-17(26-23(29)30-12-14-8-5-4-6-9-14)21(27)32-19-11-18-15(10-16(19)24)13(2)20(25)22(28)31-18/h4-6,8-11,17H,3,7,12H2,1-2H3,(H,26,29)/t17-/m1/s1 |
| InChIKey | FCXHHUNSXKSUJD-QGZVFWFLSA-N |
| XLogP | 5.41 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.33 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|