C30H30ClNO6S — CID 2068596
(3-benzyl-6-chloro-4-methyl-2-oxochromen-7-yl) (2R)-2-[(4-methylphenyl)sulfonylamino]hexanoate (PubChem CID 2068596) has the molecular formula C30H30ClNO6S and a molecular weight of 568.09 g/mol. Its IUPAC name is (3-benzyl-6-chloro-4-methyl-2-oxochromen-7-yl) (2R)-2-[(4-methylphenyl)sulfonylamino]hexanoate.
| Compound Name | (3-benzyl-6-chloro-4-methyl-2-oxochromen-7-yl) (2R)-2-[(4-methylphenyl)sulfonylamino]hexanoate |
|---|---|
| PubChem CID | 2068596 |
| Molecular Formula | C30H30ClNO6S |
| Molecular Weight | 568.09 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | (3-benzyl-6-chloro-4-methyl-2-oxochromen-7-yl) (2R)-2-[(4-methylphenyl)sulfonylamino]hexanoate |
| SMILES | CCCC[C@@H](NS(=O)(=O)c1ccc(C)cc1)C(=O)Oc1cc2oc(=O)c(Cc3ccccc3)c(C)c2cc1Cl |
| InChI | InChI=1S/C30H30ClNO6S/c1-4-5-11-26(32-39(35,36)22-14-12-19(2)13-15-22)30(34)38-28-18-27-23(17-25(28)31)20(3)24(29(33)37-27)16-21-9-7-6-8-10-21/h6-10,12-15,17-18,26,32H,4-5,11,16H2,1-3H3/t26-/m1/s1 |
| InChIKey | FXANKVJAIYDTBI-AREMUKBSSA-N |
| XLogP | 6.10 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.09 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|