C31H33NO6S — CID 3846407
(3-benzyl-4,8-dimethyl-2-oxochromen-7-yl) 2-[(4-methylphenyl)sulfonylamino]hexanoate (PubChem CID 3846407) has the molecular formula C31H33NO6S and a molecular weight of 547.67 g/mol. Its IUPAC name is (3-benzyl-4,8-dimethyl-2-oxochromen-7-yl) 2-[(4-methylphenyl)sulfonylamino]hexanoate.
| Compound Name | (3-benzyl-4,8-dimethyl-2-oxochromen-7-yl) 2-[(4-methylphenyl)sulfonylamino]hexanoate |
|---|---|
| PubChem CID | 3846407 |
| Molecular Formula | C31H33NO6S |
| Molecular Weight | 547.67 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | (3-benzyl-4,8-dimethyl-2-oxochromen-7-yl) 2-[(4-methylphenyl)sulfonylamino]hexanoate |
| SMILES | CCCCC(NS(=O)(=O)c1ccc(C)cc1)C(=O)Oc1ccc2c(C)c(Cc3ccccc3)c(=O)oc2c1C |
| InChI | InChI=1S/C31H33NO6S/c1-5-6-12-27(32-39(35,36)24-15-13-20(2)14-16-24)31(34)37-28-18-17-25-21(3)26(19-23-10-8-7-9-11-23)30(33)38-29(25)22(28)4/h7-11,13-18,27,32H,5-6,12,19H2,1-4H3 |
| InChIKey | RZAHEOAOGUZTFM-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.67 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|