C30H31NO6S — CID 98317574
(3-benzyl-4,8-dimethyl-2-oxochromen-7-yl) (2R)-3-methyl-2-[(4-methylphenyl)sulfonylamino]butanoate (PubChem CID 98317574) has the molecular formula C30H31NO6S and a molecular weight of 533.65 g/mol. Its IUPAC name is (3-benzyl-4,8-dimethyl-2-oxochromen-7-yl) (2R)-3-methyl-2-[(4-methylphenyl)sulfonylamino]butanoate.
| Compound Name | (3-benzyl-4,8-dimethyl-2-oxochromen-7-yl) (2R)-3-methyl-2-[(4-methylphenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 98317574 |
| Molecular Formula | C30H31NO6S |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | (3-benzyl-4,8-dimethyl-2-oxochromen-7-yl) (2R)-3-methyl-2-[(4-methylphenyl)sulfonylamino]butanoate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](C(=O)Oc2ccc3c(C)c(Cc4ccccc4)c(=O)oc3c2C)C(C)C)cc1 |
| InChI | InChI=1S/C30H31NO6S/c1-18(2)27(31-38(34,35)23-13-11-19(3)12-14-23)30(33)36-26-16-15-24-20(4)25(17-22-9-7-6-8-10-22)29(32)37-28(24)21(26)5/h6-16,18,27,31H,17H2,1-5H3/t27-/m1/s1 |
| InChIKey | MVYDIUREGJBVCO-HHHXNRCGSA-N |
| XLogP | 5.22 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|